C25H23N3O4S2 — CID 2139458
N-benzyl-2-[(3Z)-2-oxo-3-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetamide (PubChem CID 2139458) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-benzyl-2-[(3Z)-2-oxo-3-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetamide.
| Compound Name | N-benzyl-2-[(3Z)-2-oxo-3-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 2139458 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-benzyl-2-[(3Z)-2-oxo-3-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]indol-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C2\SC(=S)N(C[C@@H]3CCCO3)C2=O)c2ccccc21)NCc1ccccc1 |
| InChI | InChI=1S/C25H23N3O4S2/c29-20(26-13-16-7-2-1-3-8-16)15-27-19-11-5-4-10-18(19)21(23(27)30)22-24(31)28(25(33)34-22)14-17-9-6-12-32-17/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,26,29)/b22-21-/t17-/m0/s1 |
| InChIKey | YXEFJKKVEHSUTN-NFFVOIMASA-N |
| XLogP | 3.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|