C26H32N2O2 — CID 21394587
ethyl 4-(4-benzylpiperazin-1-yl)-1-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 21394587) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl 4-(4-benzylpiperazin-1-yl)-1-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 4-(4-benzylpiperazin-1-yl)-1-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 21394587 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | ethyl 4-(4-benzylpiperazin-1-yl)-1-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)C=CC(N2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H32N2O2/c1-2-30-25(29)26(23-11-7-4-8-12-23)15-13-24(14-16-26)28-19-17-27(18-20-28)21-22-9-5-3-6-10-22/h3-13,15,24H,2,14,16-21H2,1H3 |
| InChIKey | ADSVAILZZNAKBP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|