C12H16O4 — CID 21396933
1,2,3,4,5,6,7,8-octahydronaphthalene-1,4-dicarboxylic acid (PubChem CID 21396933) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octahydronaphthalene-1,4-dicarboxylic acid.
| Compound Name | 1,2,3,4,5,6,7,8-octahydronaphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 21396933 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octahydronaphthalene-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)O)C2=C1CCCC2 |
| InChI | InChI=1S/C12H16O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h9-10H,1-6H2,(H,13,14)(H,15,16) |
| InChIKey | IFEDATXGPTZIDN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|