About methyl N'-propylcarbamimidothioate;hydroiodide
methyl N'-propylcarbamimidothioate;hydroiodide (PubChem CID 21400264) has the molecular formula C5H13IN2S
and a molecular weight of 260.14 g/mol. Its IUPAC name is methyl N'-propylcarbamimidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl N'-propylcarbamimidothioate;hydroiodide |
| PubChem CID | 21400264 |
| Molecular Formula | C5H13IN2S |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | methyl N'-propylcarbamimidothioate;hydroiodide |
| SMILES | CCC/N=C(/N)SC.I |
| InChI | InChI=1S/C5H12N2S.HI/c1-3-4-7-5(6)8-2;/h3-4H2,1-2H3,(H2,6,7);1H |
| InChIKey | XNVBVEUUKLZRAR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-propylcarbamimidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-propylcarbamimidothioate;hydroiodide?
The IUPAC name of methyl N'-propylcarbamimidothioate;hydroiodide (CID 21400264) is methyl N'-propylcarbamimidothioate;hydroiodide.
What is the SMILES notation for methyl N'-propylcarbamimidothioate;hydroiodide?
The canonical SMILES for methyl N'-propylcarbamimidothioate;hydroiodide is CCC/N=C(/N)SC.I.
What is the InChIKey of methyl N'-propylcarbamimidothioate;hydroiodide?
The InChIKey is XNVBVEUUKLZRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2S.HI/c1-3-4-7-5(6)8-2;/h3-4H2,1-2H3,(H2,6,7);1H.
What are the key properties of methyl N'-propylcarbamimidothioate;hydroiodide?
methyl N'-propylcarbamimidothioate;hydroiodide has a molecular weight of 260.14 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-propylcarbamimidothioate;hydroiodide is sourced from PubChem (CID 21400264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).