C11H19N3O2S — CID 21400311
1-cyclohexyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione (PubChem CID 21400311) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-cyclohexyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-cyclohexyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 21400311 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-cyclohexyl-3,6-dimethyl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
| SMILES | CN1C(=O)NC(C)(S)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C11H19N3O2S/c1-11(17)12-9(15)13(2)10(16)14(11)8-6-4-3-5-7-8/h8,17H,3-7H2,1-2H3,(H,12,15) |
| InChIKey | MSHWZPMRQTVRBX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|