C13H23N3O2S — CID 21400310
3-cyclohexyl-6-methyl-1-propan-2-yl-6-sulfanyl-1,3,5-triazinane-2,4-dione (PubChem CID 21400310) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-cyclohexyl-6-methyl-1-propan-2-yl-6-sulfanyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 3-cyclohexyl-6-methyl-1-propan-2-yl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 21400310 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-cyclohexyl-6-methyl-1-propan-2-yl-6-sulfanyl-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)N1C(=O)N(C2CCCCC2)C(=O)NC1(C)S |
| InChI | InChI=1S/C13H23N3O2S/c1-9(2)16-12(18)15(10-7-5-4-6-8-10)11(17)14-13(16,3)19/h9-10,19H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | KJWJVXUDHIYGTB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|