C15H19Cl2NOS2 — CID 21403914
2-chloro-N-(4-chloro-2-methylphenyl)-N-(1,3-dithiepan-2-ylmethyl)acetamide (PubChem CID 21403914) has the molecular formula C15H19Cl2NOS2 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-2-methylphenyl)-N-(1,3-dithiepan-2-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-(4-chloro-2-methylphenyl)-N-(1,3-dithiepan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 21403914 |
| Molecular Formula | C15H19Cl2NOS2 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-chloro-N-(4-chloro-2-methylphenyl)-N-(1,3-dithiepan-2-ylmethyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1N(CC1SCCCCS1)C(=O)CCl |
| InChI | InChI=1S/C15H19Cl2NOS2/c1-11-8-12(17)4-5-13(11)18(14(19)9-16)10-15-20-6-2-3-7-21-15/h4-5,8,15H,2-3,6-7,9-10H2,1H3 |
| InChIKey | HIJHXOQRTMWROU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|