C21H25N5O4S — CID 21404817
[3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 2-(4-cyanophenoxy)acetate (PubChem CID 21404817) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 21404817 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-3-oxidoimidazolidin-3-ium-4-yl] 2-(4-cyanophenoxy)acetate |
| SMILES | CN1CC(OC(=O)COc2ccc(C#N)cc2)[N+]([O-])(c2nnc(C3CCCCC3)s2)C1 |
| InChI | InChI=1S/C21H25N5O4S/c1-25-12-18(30-19(27)13-29-17-9-7-15(11-22)8-10-17)26(28,14-25)21-24-23-20(31-21)16-5-3-2-4-6-16/h7-10,16,18H,2-6,12-14H2,1H3 |
| InChIKey | ISSUQLGKDWLSIS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|