C19H20ClNO4 — CID 21405540
2-(3-chlorophenyl)-4-methyl-2,6,7,8,9,10-hexahydropyrido[1,2-a]azepine-1,3-dicarboxylic acid (PubChem CID 21405540) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-methyl-2,6,7,8,9,10-hexahydropyrido[1,2-a]azepine-1,3-dicarboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-4-methyl-2,6,7,8,9,10-hexahydropyrido[1,2-a]azepine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 21405540 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(3-chlorophenyl)-4-methyl-2,6,7,8,9,10-hexahydropyrido[1,2-a]azepine-1,3-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(Cl)c2)C(C(=O)O)=C2CCCCCN12 |
| InChI | InChI=1S/C19H20ClNO4/c1-11-15(18(22)23)16(12-6-5-7-13(20)10-12)17(19(24)25)14-8-3-2-4-9-21(11)14/h5-7,10,16H,2-4,8-9H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | OSRRYLPBORGJBQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |