C22H26S — CID 21406595
2,3-dibutylanthracene-1-thiol (PubChem CID 21406595) has the molecular formula C22H26S and a molecular weight of 322.52 g/mol. Its IUPAC name is 2,3-dibutylanthracene-1-thiol.
| Compound Name | 2,3-dibutylanthracene-1-thiol |
|---|---|
| PubChem CID | 21406595 |
| Molecular Formula | C22H26S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2,3-dibutylanthracene-1-thiol |
| SMILES | CCCCc1cc2cc3ccccc3cc2c(S)c1CCCC |
| InChI | InChI=1S/C22H26S/c1-3-5-9-18-14-19-13-16-10-7-8-11-17(16)15-21(19)22(23)20(18)12-6-4-2/h7-8,10-11,13-15,23H,3-6,9,12H2,1-2H3 |
| InChIKey | XMSMKFDCECLDIZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|