C18H15F3O4 — CID 21406747
2-[4-(2,4-difluorophenyl)-3-fluorophenyl]-3-ethoxy-2-methyl-3-oxopropanoic acid (PubChem CID 21406747) has the molecular formula C18H15F3O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]-3-ethoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]-3-ethoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21406747 |
| Molecular Formula | C18H15F3O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]-3-ethoxy-2-methyl-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C)(C(=O)O)c1ccc(-c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H15F3O4/c1-3-25-17(24)18(2,16(22)23)10-4-6-12(14(20)8-10)13-7-5-11(19)9-15(13)21/h4-9H,3H2,1-2H3,(H,22,23) |
| InChIKey | GCSRPTQFOVJPPV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|