C14H22ClNO4S — CID 21407808
(3-tert-butyl-1,3-oxazolidin-5-yl)methyl benzenesulfonate;hydrochloride (PubChem CID 21407808) has the molecular formula C14H22ClNO4S and a molecular weight of 335.85 g/mol. Its IUPAC name is (3-tert-butyl-1,3-oxazolidin-5-yl)methyl benzenesulfonate;hydrochloride.
| Compound Name | (3-tert-butyl-1,3-oxazolidin-5-yl)methyl benzenesulfonate;hydrochloride |
|---|---|
| PubChem CID | 21407808 |
| Molecular Formula | C14H22ClNO4S |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (3-tert-butyl-1,3-oxazolidin-5-yl)methyl benzenesulfonate;hydrochloride |
| SMILES | CC(C)(C)N1COC(COS(=O)(=O)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H21NO4S.ClH/c1-14(2,3)15-9-12(18-11-15)10-19-20(16,17)13-7-5-4-6-8-13;/h4-8,12H,9-11H2,1-3H3;1H |
| InChIKey | QAGWEKXTGLXISC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|