About hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate
hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate (PubChem CID 21412531) has the molecular formula C20H21F5O2
and a molecular weight of 388.38 g/mol. Its IUPAC name is hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate.
Molecular Properties
| Compound Name | hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
| PubChem CID | 21412531 |
| Molecular Formula | C20H21F5O2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
| SMILES | CCCCCCOC(=O)C(c1ccc2cc(C(F)(F)F)ccc2c1)C(F)F |
| InChI | InChI=1S/C20H21F5O2/c1-2-3-4-5-10-27-19(26)17(18(21)22)15-7-6-14-12-16(20(23,24)25)9-8-13(14)11-15/h6-9,11-12,17-18H,2-5,10H2,1H3 |
| InChIKey | QNLYXYWTYZCPFH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate?
The IUPAC name of hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate (CID 21412531) is hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate.
What is the SMILES notation for hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate?
The canonical SMILES for hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate is CCCCCCOC(=O)C(c1ccc2cc(C(F)(F)F)ccc2c1)C(F)F.
What is the InChIKey of hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate?
The InChIKey is QNLYXYWTYZCPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F5O2/c1-2-3-4-5-10-27-19(26)17(18(21)22)15-7-6-14-12-16(20(23,24)25)9-8-13(14)11-15/h6-9,11-12,17-18H,2-5,10H2,1H3.
What are the key properties of hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate?
hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate has a molecular weight of 388.38 g/mol, XLogP of 6.33, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate is sourced from PubChem (CID 21412531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).