C20H21F5O2 — CID 21412531
hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate (PubChem CID 21412531) has the molecular formula C20H21F5O2 and a molecular weight of 388.38 g/mol. Its IUPAC name is hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate.
| Compound Name | hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 21412531 |
| Molecular Formula | C20H21F5O2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | hexyl 3,3-difluoro-2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
| SMILES | CCCCCCOC(=O)C(c1ccc2cc(C(F)(F)F)ccc2c1)C(F)F |
| InChI | InChI=1S/C20H21F5O2/c1-2-3-4-5-10-27-19(26)17(18(21)22)15-7-6-14-12-16(20(23,24)25)9-8-13(14)11-15/h6-9,11-12,17-18H,2-5,10H2,1H3 |
| InChIKey | QNLYXYWTYZCPFH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|