C13H12N2OS — CID 21412665
bicyclo[2.2.0]hexa-1(4),2,5-triene;1-hydroxy-1-phenylthiourea (PubChem CID 21412665) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1(4),2,5-triene;1-hydroxy-1-phenylthiourea.
| Compound Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;1-hydroxy-1-phenylthiourea |
|---|---|
| PubChem CID | 21412665 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;1-hydroxy-1-phenylthiourea |
| SMILES | NC(=S)N(O)c1ccccc1.c1cc2ccc1=2 |
| InChI | InChI=1S/C7H8N2OS.C6H4/c8-7(11)9(10)6-4-2-1-3-5-6;1-2-6-4-3-5(1)6/h1-5,10H,(H2,8,11);1-4H |
| InChIKey | ZCSCGTPVKXTWPP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|