About 2-ethylbutanedioyl dibromide
2-ethylbutanedioyl dibromide (PubChem CID 21416014) has the molecular formula C6H8Br2O2
and a molecular weight of 271.94 g/mol. Its IUPAC name is 2-ethylbutanedioyl dibromide.
Molecular Properties
| Compound Name | 2-ethylbutanedioyl dibromide |
| PubChem CID | 21416014 |
| Molecular Formula | C6H8Br2O2 |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | 2-ethylbutanedioyl dibromide |
| SMILES | CCC(CC(=O)Br)C(=O)Br |
| InChI | InChI=1S/C6H8Br2O2/c1-2-4(6(8)10)3-5(7)9/h4H,2-3H2,1H3 |
| InChIKey | IHRJXBGFXBQOTC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutanedioyl dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutanedioyl dibromide?
The IUPAC name of 2-ethylbutanedioyl dibromide (CID 21416014) is 2-ethylbutanedioyl dibromide.
What is the SMILES notation for 2-ethylbutanedioyl dibromide?
The canonical SMILES for 2-ethylbutanedioyl dibromide is CCC(CC(=O)Br)C(=O)Br.
What is the InChIKey of 2-ethylbutanedioyl dibromide?
The InChIKey is IHRJXBGFXBQOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2O2/c1-2-4(6(8)10)3-5(7)9/h4H,2-3H2,1H3.
What are the key properties of 2-ethylbutanedioyl dibromide?
2-ethylbutanedioyl dibromide has a molecular weight of 271.94 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutanedioyl dibromide is sourced from PubChem (CID 21416014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).