C21H27N3O3S — CID 21416973
2-[benzyl(propan-2-yl)amino]-1-[4-(cyclopropylsulfamoylamino)phenyl]ethanone (PubChem CID 21416973) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-[benzyl(propan-2-yl)amino]-1-[4-(cyclopropylsulfamoylamino)phenyl]ethanone.
| Compound Name | 2-[benzyl(propan-2-yl)amino]-1-[4-(cyclopropylsulfamoylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 21416973 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[benzyl(propan-2-yl)amino]-1-[4-(cyclopropylsulfamoylamino)phenyl]ethanone |
| SMILES | CC(C)N(CC(=O)c1ccc(NS(=O)(=O)NC2CC2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-16(2)24(14-17-6-4-3-5-7-17)15-21(25)18-8-10-19(11-9-18)22-28(26,27)23-20-12-13-20/h3-11,16,20,22-23H,12-15H2,1-2H3 |
| InChIKey | ARRIICMHRPRJMD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |