C14H14ClN3O2 — CID 21417382
2-chloro-3,6-dimethoxy-4-phenyldiazenylaniline (PubChem CID 21417382) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-chloro-3,6-dimethoxy-4-phenyldiazenylaniline.
| Compound Name | 2-chloro-3,6-dimethoxy-4-phenyldiazenylaniline |
|---|---|
| PubChem CID | 21417382 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-chloro-3,6-dimethoxy-4-phenyldiazenylaniline |
| SMILES | COc1cc(/N=N/c2ccccc2)c(OC)c(Cl)c1N |
| InChI | InChI=1S/C14H14ClN3O2/c1-19-11-8-10(14(20-2)12(15)13(11)16)18-17-9-6-4-3-5-7-9/h3-8H,16H2,1-2H3/b18-17+ |
| InChIKey | UPMDFNRWOCSXGJ-ISLYRVAYSA-N |
| XLogP | 4.35 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|