C31H32N2O — CID 21342333
[2-methoxy-3,5-bis(2-phenylpropan-2-yl)phenyl]-phenyldiazene (PubChem CID 21342333) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is [2-methoxy-3,5-bis(2-phenylpropan-2-yl)phenyl]-phenyldiazene.
| Compound Name | [2-methoxy-3,5-bis(2-phenylpropan-2-yl)phenyl]-phenyldiazene |
|---|---|
| PubChem CID | 21342333 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [2-methoxy-3,5-bis(2-phenylpropan-2-yl)phenyl]-phenyldiazene |
| SMILES | COc1c(/N=N/c2ccccc2)cc(C(C)(C)c2ccccc2)cc1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O/c1-30(2,23-15-9-6-10-16-23)25-21-27(31(3,4)24-17-11-7-12-18-24)29(34-5)28(22-25)33-32-26-19-13-8-14-20-26/h6-22H,1-5H3/b33-32+ |
| InChIKey | MWMWGFOUGUROAS-ULIFNZDWSA-N |
| XLogP | 8.76 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|