C24H26O2P- — CID 102133332
2-hydroxyphosphanyl-4,6-bis(2-phenylpropan-2-yl)phenolate (PubChem CID 102133332) has the molecular formula C24H26O2P- and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-hydroxyphosphanyl-4,6-bis(2-phenylpropan-2-yl)phenolate.
| Compound Name | 2-hydroxyphosphanyl-4,6-bis(2-phenylpropan-2-yl)phenolate |
|---|---|
| PubChem CID | 102133332 |
| Molecular Formula | C24H26O2P- |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-hydroxyphosphanyl-4,6-bis(2-phenylpropan-2-yl)phenolate |
| SMILES | CC(C)(c1ccccc1)c1cc(PO)c([O-])c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27O2P/c1-23(2,17-11-7-5-8-12-17)19-15-20(22(25)21(16-19)27-26)24(3,4)18-13-9-6-10-14-18/h5-16,25-27H,1-4H3/p-1 |
| InChIKey | HBQSTGXQDOXCKJ-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|