C35H54N2O4S — CID 21421482
11-[2-(3-butyl-4-hydroxy-5-methylanilino)-2-oxoethyl]sulfanyl-N-(3-butyl-4-hydroxy-5-methylphenyl)undecanamide (PubChem CID 21421482) has the molecular formula C35H54N2O4S and a molecular weight of 598.89 g/mol. Its IUPAC name is 11-[2-(3-butyl-4-hydroxy-5-methylanilino)-2-oxoethyl]sulfanyl-N-(3-butyl-4-hydroxy-5-methylphenyl)undecanamide.
| Compound Name | 11-[2-(3-butyl-4-hydroxy-5-methylanilino)-2-oxoethyl]sulfanyl-N-(3-butyl-4-hydroxy-5-methylphenyl)undecanamide |
|---|---|
| PubChem CID | 21421482 |
| Molecular Formula | C35H54N2O4S |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | 11-[2-(3-butyl-4-hydroxy-5-methylanilino)-2-oxoethyl]sulfanyl-N-(3-butyl-4-hydroxy-5-methylphenyl)undecanamide |
| SMILES | CCCCc1cc(NC(=O)CCCCCCCCCCSCC(=O)Nc2cc(C)c(O)c(CCCC)c2)cc(C)c1O |
| InChI | InChI=1S/C35H54N2O4S/c1-5-7-17-28-23-30(21-26(3)34(28)40)36-32(38)19-15-13-11-9-10-12-14-16-20-42-25-33(39)37-31-22-27(4)35(41)29(24-31)18-8-6-2/h21-24,40-41H,5-20,25H2,1-4H3,(H,36,38)(H,37,39) |
| InChIKey | QBVHUOKBMCKSEA-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|