C21H31NO4S — CID 59933712
3-[2,4-dimethyl-3-[(2-octylsulfanylacetyl)amino]phenyl]-2-oxopropanoic acid (PubChem CID 59933712) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 3-[2,4-dimethyl-3-[(2-octylsulfanylacetyl)amino]phenyl]-2-oxopropanoic acid.
| Compound Name | 3-[2,4-dimethyl-3-[(2-octylsulfanylacetyl)amino]phenyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 59933712 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 3-[2,4-dimethyl-3-[(2-octylsulfanylacetyl)amino]phenyl]-2-oxopropanoic acid |
| SMILES | CCCCCCCCSCC(=O)Nc1c(C)ccc(CC(=O)C(=O)O)c1C |
| InChI | InChI=1S/C21H31NO4S/c1-4-5-6-7-8-9-12-27-14-19(24)22-20-15(2)10-11-17(16(20)3)13-18(23)21(25)26/h10-11H,4-9,12-14H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | WYCGNYVZTMUJGR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|