C26H36N2S — CID 21424039
1-[2-(1-adamantyl)-2-(4-tert-butyl-2-methylphenyl)sulfanylethyl]imidazole (PubChem CID 21424039) has the molecular formula C26H36N2S and a molecular weight of 408.66 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-2-(4-tert-butyl-2-methylphenyl)sulfanylethyl]imidazole.
| Compound Name | 1-[2-(1-adamantyl)-2-(4-tert-butyl-2-methylphenyl)sulfanylethyl]imidazole |
|---|---|
| PubChem CID | 21424039 |
| Molecular Formula | C26H36N2S |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-[2-(1-adamantyl)-2-(4-tert-butyl-2-methylphenyl)sulfanylethyl]imidazole |
| SMILES | Cc1cc(C(C)(C)C)ccc1SC(Cn1ccnc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H36N2S/c1-18-9-22(25(2,3)4)5-6-23(18)29-24(16-28-8-7-27-17-28)26-13-19-10-20(14-26)12-21(11-19)15-26/h5-9,17,19-21,24H,10-16H2,1-4H3 |
| InChIKey | QPMYYCVXQWNPKK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |