C22H27BrN2S — CID 21424088
1-[2-(1-adamantyl)-2-(3-bromo-4-methylphenyl)sulfanylethyl]imidazole (PubChem CID 21424088) has the molecular formula C22H27BrN2S and a molecular weight of 431.44 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-2-(3-bromo-4-methylphenyl)sulfanylethyl]imidazole.
| Compound Name | 1-[2-(1-adamantyl)-2-(3-bromo-4-methylphenyl)sulfanylethyl]imidazole |
|---|---|
| PubChem CID | 21424088 |
| Molecular Formula | C22H27BrN2S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-[2-(1-adamantyl)-2-(3-bromo-4-methylphenyl)sulfanylethyl]imidazole |
| SMILES | Cc1ccc(SC(Cn2ccnc2)C23CC4CC(CC(C4)C2)C3)cc1Br |
| InChI | InChI=1S/C22H27BrN2S/c1-15-2-3-19(9-20(15)23)26-21(13-25-5-4-24-14-25)22-10-16-6-17(11-22)8-18(7-16)12-22/h2-5,9,14,16-18,21H,6-8,10-13H2,1H3 |
| InChIKey | GDKUXGDTYIDTSZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |