C32H50O8S2 — CID 21424428
3,4-bis[1-(3-carboxyoctylsulfanyl)propyl]phthalic acid (PubChem CID 21424428) has the molecular formula C32H50O8S2 and a molecular weight of 626.88 g/mol. Its IUPAC name is 3,4-bis[1-(3-carboxyoctylsulfanyl)propyl]phthalic acid.
| Compound Name | 3,4-bis[1-(3-carboxyoctylsulfanyl)propyl]phthalic acid |
|---|---|
| PubChem CID | 21424428 |
| Molecular Formula | C32H50O8S2 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 3,4-bis[1-(3-carboxyoctylsulfanyl)propyl]phthalic acid |
| SMILES | CCCCCC(CCSC(CC)c1ccc(C(=O)O)c(C(=O)O)c1C(CC)SCCC(CCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C32H50O8S2/c1-5-9-11-13-21(29(33)34)17-19-41-25(7-3)23-15-16-24(31(37)38)28(32(39)40)27(23)26(8-4)42-20-18-22(30(35)36)14-12-10-6-2/h15-16,21-22,25-26H,5-14,17-20H2,1-4H3,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | RICWCUOPQKDHFH-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|