C30H48O6S2-2 — CID 21424488
3,4-bis[1-(3-hydroxyoctylsulfanyl)propyl]phthalate (PubChem CID 21424488) has the molecular formula C30H48O6S2-2 and a molecular weight of 568.84 g/mol. Its IUPAC name is 3,4-bis[1-(3-hydroxyoctylsulfanyl)propyl]phthalate.
| Compound Name | 3,4-bis[1-(3-hydroxyoctylsulfanyl)propyl]phthalate |
|---|---|
| PubChem CID | 21424488 |
| Molecular Formula | C30H48O6S2-2 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 3,4-bis[1-(3-hydroxyoctylsulfanyl)propyl]phthalate |
| SMILES | CCCCCC(O)CCSC(CC)c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(CC)SCCC(O)CCCCC |
| InChI | InChI=1S/C30H50O6S2/c1-5-9-11-13-21(31)17-19-37-25(7-3)23-15-16-24(29(33)34)28(30(35)36)27(23)26(8-4)38-20-18-22(32)14-12-10-6-2/h15-16,21-22,25-26,31-32H,5-14,17-20H2,1-4H3,(H,33,34)(H,35,36)/p-2 |
| InChIKey | RMABZHWOTHOLTC-UHFFFAOYSA-L |
| XLogP | 5.44 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|