C26H36O8S2-2 — CID 21424417
3,4-bis[1-(3-carboxypentylsulfanyl)propyl]phthalate (PubChem CID 21424417) has the molecular formula C26H36O8S2-2 and a molecular weight of 540.70 g/mol. Its IUPAC name is 3,4-bis[1-(3-carboxypentylsulfanyl)propyl]phthalate.
| Compound Name | 3,4-bis[1-(3-carboxypentylsulfanyl)propyl]phthalate |
|---|---|
| PubChem CID | 21424417 |
| Molecular Formula | C26H36O8S2-2 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 3,4-bis[1-(3-carboxypentylsulfanyl)propyl]phthalate |
| SMILES | CCC(CCSC(CC)c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(CC)SCCC(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H38O8S2/c1-5-15(23(27)28)11-13-35-19(7-3)17-9-10-18(25(31)32)22(26(33)34)21(17)20(8-4)36-14-12-16(6-2)24(29)30/h9-10,15-16,19-20H,5-8,11-14H2,1-4H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34)/p-2 |
| InChIKey | BURIRHHARONZDV-UHFFFAOYSA-L |
| XLogP | 3.78 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |