C24H36O4-2 — CID 71436144
3,4-bis(6-methylheptan-3-yl)phthalate (PubChem CID 71436144) has the molecular formula C24H36O4-2 and a molecular weight of 388.55 g/mol. Its IUPAC name is 3,4-bis(6-methylheptan-3-yl)phthalate.
| Compound Name | 3,4-bis(6-methylheptan-3-yl)phthalate |
|---|---|
| PubChem CID | 71436144 |
| Molecular Formula | C24H36O4-2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 3,4-bis(6-methylheptan-3-yl)phthalate |
| SMILES | CCC(CCC(C)C)c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(CC)CCC(C)C |
| InChI | InChI=1S/C24H38O4/c1-7-17(11-9-15(3)4)19-13-14-20(23(25)26)22(24(27)28)21(19)18(8-2)12-10-16(5)6/h13-18H,7-12H2,1-6H3,(H,25,26)(H,27,28)/p-2 |
| InChIKey | MJNDWTTWEXHCCG-UHFFFAOYSA-L |
| XLogP | 4.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |