C13H17NaO3 — CID 159643835
sodium 2-hydroxy-3,4-di(propan-2-yl)benzoate (PubChem CID 159643835) has the molecular formula C13H17NaO3 and a molecular weight of 244.27 g/mol. Its IUPAC name is sodium 2-hydroxy-3,4-di(propan-2-yl)benzoate.
| Compound Name | sodium 2-hydroxy-3,4-di(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 159643835 |
| Molecular Formula | C13H17NaO3 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | sodium 2-hydroxy-3,4-di(propan-2-yl)benzoate |
| SMILES | CC(C)c1ccc(C(=O)[O-])c(O)c1C(C)C.[Na+] |
| InChI | InChI=1S/C13H18O3.Na/c1-7(2)9-5-6-10(13(15)16)12(14)11(9)8(3)4;/h5-8,14H,1-4H3,(H,15,16);/q;+1/p-1 |
| InChIKey | MQRUUVCTMOHXFY-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |