About 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid
2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid (PubChem CID 67764185) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid |
| PubChem CID | 67764185 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid |
| SMILES | C1=Cc2ccccc2OC1.CC(C)c1ccc(C(=O)O)c(O)c1C(C)C |
| InChI | InChI=1S/C13H18O3.C9H8O/c1-7(2)9-5-6-10(13(15)16)12(14)11(9)8(3)4;1-2-6-9-8(4-1)5-3-7-10-9/h5-8,14H,1-4H3,(H,15,16);1-6H,7H2 |
| InChIKey | AGVKHGXAOOCBQZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid?
The IUPAC name of 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid (CID 67764185) is 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid.
What is the SMILES notation for 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid?
The canonical SMILES for 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid is C1=Cc2ccccc2OC1.CC(C)c1ccc(C(=O)O)c(O)c1C(C)C.
What is the InChIKey of 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid?
The InChIKey is AGVKHGXAOOCBQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3.C9H8O/c1-7(2)9-5-6-10(13(15)16)12(14)11(9)8(3)4;1-2-6-9-8(4-1)5-3-7-10-9/h5-8,14H,1-4H3,(H,15,16);1-6H,7H2.
What are the key properties of 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid?
2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid has a molecular weight of 354.45 g/mol, XLogP of 5.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;2-hydroxy-3,4-di(propan-2-yl)benzoic acid is sourced from PubChem (CID 67764185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).