C26H28O8-4 — CID 22373965
3,4-diethylphthalate;3-hexan-3-ylphthalate (PubChem CID 22373965) has the molecular formula C26H28O8-4 and a molecular weight of 468.50 g/mol. Its IUPAC name is 3,4-diethylphthalate;3-hexan-3-ylphthalate.
| Compound Name | 3,4-diethylphthalate;3-hexan-3-ylphthalate |
|---|---|
| PubChem CID | 22373965 |
| Molecular Formula | C26H28O8-4 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3,4-diethylphthalate;3-hexan-3-ylphthalate |
| SMILES | CCCC(CC)c1cccc(C(=O)[O-])c1C(=O)[O-].CCc1ccc(C(=O)[O-])c(C(=O)[O-])c1CC |
| InChI | InChI=1S/C14H18O4.C12H14O4/c1-3-6-9(4-2)10-7-5-8-11(13(15)16)12(10)14(17)18;1-3-7-5-6-9(11(13)14)10(12(15)16)8(7)4-2/h5,7-9H,3-4,6H2,1-2H3,(H,15,16)(H,17,18);5-6H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-4 |
| InChIKey | GPQYVCJIEBFPNH-UHFFFAOYSA-J |
| XLogP | 0.25 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |