C20H28O4S2-2 — CID 21424475
3,4-bis(3-propylsulfanylpropyl)phthalate (PubChem CID 21424475) has the molecular formula C20H28O4S2-2 and a molecular weight of 396.57 g/mol. Its IUPAC name is 3,4-bis(3-propylsulfanylpropyl)phthalate.
| Compound Name | 3,4-bis(3-propylsulfanylpropyl)phthalate |
|---|---|
| PubChem CID | 21424475 |
| Molecular Formula | C20H28O4S2-2 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3,4-bis(3-propylsulfanylpropyl)phthalate |
| SMILES | CCCSCCCc1ccc(C(=O)[O-])c(C(=O)[O-])c1CCCSCCC |
| InChI | InChI=1S/C20H30O4S2/c1-3-11-25-13-5-7-15-9-10-17(19(21)22)18(20(23)24)16(15)8-6-14-26-12-4-2/h9-10H,3-8,11-14H2,1-2H3,(H,21,22)(H,23,24)/p-2 |
| InChIKey | MJCDWGLOHQZXFC-UHFFFAOYSA-L |
| XLogP | 2.57 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|