C20H24O4-2 — CID 21120418
3,4-bis(hex-5-enyl)phthalate (PubChem CID 21120418) has the molecular formula C20H24O4-2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3,4-bis(hex-5-enyl)phthalate.
| Compound Name | 3,4-bis(hex-5-enyl)phthalate |
|---|---|
| PubChem CID | 21120418 |
| Molecular Formula | C20H24O4-2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3,4-bis(hex-5-enyl)phthalate |
| SMILES | C=CCCCCc1ccc(C(=O)[O-])c(C(=O)[O-])c1CCCCC=C |
| InChI | InChI=1S/C20H26O4/c1-3-5-7-9-11-15-13-14-17(19(21)22)18(20(23)24)16(15)12-10-8-6-4-2/h3-4,13-14H,1-2,5-12H2,(H,21,22)(H,23,24)/p-2 |
| InChIKey | RGPULHIVXMGGLM-UHFFFAOYSA-L |
| XLogP | 2.21 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|