C22H19F3N2O3 — CID 21428735
1-(1H-indol-3-yl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethane-1,2-dione (PubChem CID 21428735) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(1H-indol-3-yl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 21428735 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(Oc2ccc(C(F)(F)F)cc2)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19F3N2O3/c23-22(24,25)14-5-7-15(8-6-14)30-16-9-11-27(12-10-16)21(29)20(28)18-13-26-19-4-2-1-3-17(18)19/h1-8,13,16,26H,9-12H2 |
| InChIKey | KQKZBDZDIHJDGI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|