C20H17F3N4O3 — CID 122267513
1-(1H-indol-3-yl)-2-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]ethane-1,2-dione (PubChem CID 122267513) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(1H-indol-3-yl)-2-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 122267513 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H17F3N4O3/c21-20(22,23)16-7-8-24-19(26-16)30-12-4-3-9-27(11-12)18(29)17(28)14-10-25-15-6-2-1-5-13(14)15/h1-2,5-8,10,12,25H,3-4,9,11H2 |
| InChIKey | DOONIJCMFYKSMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|