C19H17ClN4O3 — CID 122259387
1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-2-(1H-indol-3-yl)ethane-1,2-dione (PubChem CID 122259387) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-2-(1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-2-(1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 122259387 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-2-(1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCC(Oc2ncc(Cl)cn2)C1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17ClN4O3/c20-12-8-22-19(23-9-12)27-13-4-3-7-24(11-13)18(26)17(25)15-10-21-16-6-2-1-5-14(15)16/h1-2,5-6,8-10,13,21H,3-4,7,11H2 |
| InChIKey | MQXDOYLDQGRENK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|