C15H15NO4 — CID 21429224
methyl 6-(methylcarbamoyloxy)tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-3-carboxylate (PubChem CID 21429224) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 6-(methylcarbamoyloxy)tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-3-carboxylate.
| Compound Name | methyl 6-(methylcarbamoyloxy)tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 21429224 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | methyl 6-(methylcarbamoyloxy)tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-3-carboxylate |
| SMILES | CNC(=O)Oc1ccc(C(=O)OC)c2c1C1C=CC2C1 |
| InChI | InChI=1S/C15H15NO4/c1-16-15(18)20-11-6-5-10(14(17)19-2)12-8-3-4-9(7-8)13(11)12/h3-6,8-9H,7H2,1-2H3,(H,16,18) |
| InChIKey | JTKPXZCEWIQOFY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|