C19H14O7S — CID 21434633
4-(2-methylphenoxy)sulfonylnaphthalene-1,8-dicarboxylic acid (PubChem CID 21434633) has the molecular formula C19H14O7S and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-(2-methylphenoxy)sulfonylnaphthalene-1,8-dicarboxylic acid.
| Compound Name | 4-(2-methylphenoxy)sulfonylnaphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 21434633 |
| Molecular Formula | C19H14O7S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-(2-methylphenoxy)sulfonylnaphthalene-1,8-dicarboxylic acid |
| SMILES | Cc1ccccc1OS(=O)(=O)c1ccc(C(=O)O)c2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C19H14O7S/c1-11-5-2-3-8-15(11)26-27(24,25)16-10-9-14(19(22)23)17-12(16)6-4-7-13(17)18(20)21/h2-10H,1H3,(H,20,21)(H,22,23) |
| InChIKey | GFJQDLNLXNRHLJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|