C11H8Cl2N2O2 — CID 21434993
7-chloro-1-ethyl-4-oxo-1,8-naphthyridine-3-carbonyl chloride (PubChem CID 21434993) has the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 7-chloro-1-ethyl-4-oxo-1,8-naphthyridine-3-carbonyl chloride.
| Compound Name | 7-chloro-1-ethyl-4-oxo-1,8-naphthyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 21434993 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 7-chloro-1-ethyl-4-oxo-1,8-naphthyridine-3-carbonyl chloride |
| SMILES | CCn1cc(C(=O)Cl)c(=O)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C11H8Cl2N2O2/c1-2-15-5-7(10(13)17)9(16)6-3-4-8(12)14-11(6)15/h3-5H,2H2,1H3 |
| InChIKey | ABQQKKPHBWPPGG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|