C25H34N2O3 — CID 21439307
(6,10,10-trimethyl-9-oxa-12-azatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3(8),4,6-tetraen-4-yl) 3-piperidin-1-ylpropanoate (PubChem CID 21439307) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is (6,10,10-trimethyl-9-oxa-12-azatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3(8),4,6-tetraen-4-yl) 3-piperidin-1-ylpropanoate.
| Compound Name | (6,10,10-trimethyl-9-oxa-12-azatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3(8),4,6-tetraen-4-yl) 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 21439307 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (6,10,10-trimethyl-9-oxa-12-azatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3(8),4,6-tetraen-4-yl) 3-piperidin-1-ylpropanoate |
| SMILES | Cc1cc(OC(=O)CCN2CCCCC2)c2c(c1)OC(C)(C)C1=C2C2CCN1CC2 |
| InChI | InChI=1S/C25H34N2O3/c1-17-15-19(29-21(28)9-12-26-10-5-4-6-11-26)23-20(16-17)30-25(2,3)24-22(23)18-7-13-27(24)14-8-18/h15-16,18H,4-14H2,1-3H3 |
| InChIKey | BQEFZUAWHSVAAM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|