C10H8Cl3FO — CID 21440287
2-(3-fluorophenyl)-2-(2,2,2-trichloroethyl)oxirane (PubChem CID 21440287) has the molecular formula C10H8Cl3FO and a molecular weight of 269.53 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-(2,2,2-trichloroethyl)oxirane.
| Compound Name | 2-(3-fluorophenyl)-2-(2,2,2-trichloroethyl)oxirane |
|---|---|
| PubChem CID | 21440287 |
| Molecular Formula | C10H8Cl3FO |
| Molecular Weight | 269.53 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 2-(3-fluorophenyl)-2-(2,2,2-trichloroethyl)oxirane |
| SMILES | Fc1cccc(C2(CC(Cl)(Cl)Cl)CO2)c1 |
| InChI | InChI=1S/C10H8Cl3FO/c11-10(12,13)5-9(6-15-9)7-2-1-3-8(14)4-7/h1-4H,5-6H2 |
| InChIKey | DFRDIDKPEKVFTP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|