C14H25N — CID 21441409
N,N-dibutylcyclohexa-1,5-dien-1-amine (PubChem CID 21441409) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N,N-dibutylcyclohexa-1,5-dien-1-amine.
| Compound Name | N,N-dibutylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 21441409 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N,N-dibutylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCCN(CCCC)C1=CCCC=C1 |
| InChI | InChI=1S/C14H25N/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14/h8,10-11H,3-7,9,12-13H2,1-2H3 |
| InChIKey | LAGHZPUIEOATEV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |