C16H9Cl4N3O — CID 21444364
5-chloro-N-(7-chloro-1,8-naphthyridin-2-yl)-2-(dichloromethyl)benzamide (PubChem CID 21444364) has the molecular formula C16H9Cl4N3O and a molecular weight of 401.08 g/mol. Its IUPAC name is 5-chloro-N-(7-chloro-1,8-naphthyridin-2-yl)-2-(dichloromethyl)benzamide.
| Compound Name | 5-chloro-N-(7-chloro-1,8-naphthyridin-2-yl)-2-(dichloromethyl)benzamide |
|---|---|
| PubChem CID | 21444364 |
| Molecular Formula | C16H9Cl4N3O |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 5-chloro-N-(7-chloro-1,8-naphthyridin-2-yl)-2-(dichloromethyl)benzamide |
| SMILES | O=C(Nc1ccc2ccc(Cl)nc2n1)c1cc(Cl)ccc1C(Cl)Cl |
| InChI | InChI=1S/C16H9Cl4N3O/c17-9-3-4-10(14(19)20)11(7-9)16(24)23-13-6-2-8-1-5-12(18)21-15(8)22-13/h1-7,14H,(H,21,22,23,24) |
| InChIKey | LAYIMFGYTYIXPS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|