C12H12ClN3O — CID 102404571
N-(7-chloro-1,8-naphthyridin-2-yl)butanamide (PubChem CID 102404571) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is N-(7-chloro-1,8-naphthyridin-2-yl)butanamide.
| Compound Name | N-(7-chloro-1,8-naphthyridin-2-yl)butanamide |
|---|---|
| PubChem CID | 102404571 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(7-chloro-1,8-naphthyridin-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C12H12ClN3O/c1-2-3-11(17)15-10-7-5-8-4-6-9(13)14-12(8)16-10/h4-7H,2-3H2,1H3,(H,14,15,16,17) |
| InChIKey | GOHSZPQYJLJYRF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|