C20H16ClN3O3 — CID 57243056
[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] butanoate (PubChem CID 57243056) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] butanoate.
| Compound Name | [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] butanoate |
|---|---|
| PubChem CID | 57243056 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] butanoate |
| SMILES | CCCC(=O)OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C20H16ClN3O3/c1-2-5-17(25)27-20-14-7-4-3-6-13(14)19(26)24(20)16-11-9-12-8-10-15(21)22-18(12)23-16/h3-4,6-11,20H,2,5H2,1H3 |
| InChIKey | WQFBIRPJXKVZHK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|