C21H19ClN4O3 — CID 22754741
[2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] N,N-diethylcarbamate (PubChem CID 22754741) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] N,N-diethylcarbamate.
| Compound Name | [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 22754741 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [2-(7-chloro-1,8-naphthyridin-2-yl)-3-oxo-1H-isoindol-1-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-3-25(4-2)21(28)29-20-15-8-6-5-7-14(15)19(27)26(20)17-12-10-13-9-11-16(22)23-18(13)24-17/h5-12,20H,3-4H2,1-2H3 |
| InChIKey | CJNJVURKPYAYOF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|