C21H19ClN6O3 — CID 22754762
[6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N-cyclohexylcarbamate (PubChem CID 22754762) has the molecular formula C21H19ClN6O3 and a molecular weight of 438.88 g/mol. Its IUPAC name is [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N-cyclohexylcarbamate.
| Compound Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 22754762 |
| Molecular Formula | C21H19ClN6O3 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC1c2nccnc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C21H19ClN6O3/c22-14-8-6-12-7-9-15(27-18(12)26-14)28-19(29)16-17(24-11-10-23-16)20(28)31-21(30)25-13-4-2-1-3-5-13/h6-11,13,20H,1-5H2,(H,25,30) |
| InChIKey | MOESFLORTNGYQN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|