C18H10ClN5O6 — CID 101220145
[(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] (2-nitrophenyl) carbonate (PubChem CID 101220145) has the molecular formula C18H10ClN5O6 and a molecular weight of 427.76 g/mol. Its IUPAC name is [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] (2-nitrophenyl) carbonate.
| Compound Name | [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] (2-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 101220145 |
| Molecular Formula | C18H10ClN5O6 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] (2-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccccc1[N+](=O)[O-])O[C@@H]1c2nccnc2C(=O)N1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H10ClN5O6/c19-10-5-6-13(22-9-10)23-16(25)14-15(21-8-7-20-14)17(23)30-18(26)29-12-4-2-1-3-11(12)24(27)28/h1-9,17H/t17-/m1/s1 |
| InChIKey | SNZHMSMHOSCVTF-QGZVFWFLSA-N |
| XLogP | 3.31 |
| TPSA | 137.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|