C20H18ClN7O4 — CID 88821472
[6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methyl-4-oxidopiperazin-4-ium-1-carboxylate (PubChem CID 88821472) has the molecular formula C20H18ClN7O4 and a molecular weight of 455.86 g/mol. Its IUPAC name is [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methyl-4-oxidopiperazin-4-ium-1-carboxylate.
| Compound Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methyl-4-oxidopiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 88821472 |
| Molecular Formula | C20H18ClN7O4 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methyl-4-oxidopiperazin-4-ium-1-carboxylate |
| SMILES | C[N+]1([O-])CCN(C(=O)OC2c3nccnc3C(=O)N2c2ccc3ccc(Cl)nc3n2)CC1 |
| InChI | InChI=1S/C20H18ClN7O4/c1-28(31)10-8-26(9-11-28)20(30)32-19-16-15(22-6-7-23-16)18(29)27(19)14-5-3-12-2-4-13(21)24-17(12)25-14/h2-7,19H,8-11H2,1H3 |
| InChIKey | GLXMOTABYQHXDQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 124.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|