5-cyclohexyl-1,2-oxazole-3-carboxylic acid

C10H13NO3 — CID 21445302

IUPAC5-cyclohexyl-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2CCCCC2)on1
InChIInChI=1S/C10H13NO3/c12-10(13)8-6-9(14-11-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,12,13)
InChIKeyMUPJTIPMJXOUGX-UHFFFAOYSA-N
MW195.22 g/mol
LogP2.42
Rot. Bonds2

About 5-cyclohexyl-1,2-oxazole-3-carboxylic acid

5-cyclohexyl-1,2-oxazole-3-carboxylic acid (PubChem CID 21445302) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-cyclohexyl-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-cyclohexyl-1,2-oxazole-3-carboxylic acid
PubChem CID21445302
Molecular FormulaC10H13NO3
Molecular Weight195.22 g/mol
Exact Mass195.09
IUPAC Name5-cyclohexyl-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2CCCCC2)on1
InChIInChI=1S/C10H13NO3/c12-10(13)8-6-9(14-11-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,12,13)
InChIKeyMUPJTIPMJXOUGX-UHFFFAOYSA-N
XLogP2.42
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-cyclohexyl-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyclohexyl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-cyclohexyl-1,2-oxazole-3-carboxylic acid (CID 21445302) is 5-cyclohexyl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-cyclohexyl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-cyclohexyl-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(C2CCCCC2)on1.
What is the InChIKey of 5-cyclohexyl-1,2-oxazole-3-carboxylic acid?
The InChIKey is MUPJTIPMJXOUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-10(13)8-6-9(14-11-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,12,13).
What are the key properties of 5-cyclohexyl-1,2-oxazole-3-carboxylic acid?
5-cyclohexyl-1,2-oxazole-3-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 21445302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).