C13H18N2 — CID 21447873
N,N-dimethylethanamine;2-phenylprop-2-enenitrile (PubChem CID 21447873) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-phenylprop-2-enenitrile.
| Compound Name | N,N-dimethylethanamine;2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 21447873 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N,N-dimethylethanamine;2-phenylprop-2-enenitrile |
| SMILES | C=C(C#N)c1ccccc1.CCN(C)C |
| InChI | InChI=1S/C9H7N.C4H11N/c1-8(7-10)9-5-3-2-4-6-9;1-4-5(2)3/h2-6H,1H2;4H2,1-3H3 |
| InChIKey | LXUOFYJSJDESQW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|